C26H21ClN2O5 — CID 14230611
2-[2-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 14230611) has the molecular formula C26H21ClN2O5 and a molecular weight of 476.92 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14230611 |
| Molecular Formula | C26H21ClN2O5 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)C(N3C(=O)c4ccccc4C3=O)C2c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H21ClN2O5/c1-33-18-12-9-16(21(13-18)34-2)14-28-22(15-7-10-17(27)11-8-15)23(26(28)32)29-24(30)19-5-3-4-6-20(19)25(29)31/h3-13,22-23H,14H2,1-2H3 |
| InChIKey | KEWADWPYKUBSSS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|