C30H31Cl2NO3 — CID 58573739
(5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 58573739) has the molecular formula C30H31Cl2NO3 and a molecular weight of 524.49 g/mol. Its IUPAC name is (5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 58573739 |
| Molecular Formula | C30H31Cl2NO3 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1(C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(Cc2ccc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C30H31Cl2NO3/c1-5-15-30(2)18-26(21-7-6-8-24(32)16-21)28(20-9-12-23(31)13-10-20)33(29(30)34)19-22-11-14-25(35-3)17-27(22)36-4/h5-14,16-17,26,28H,1,15,18-19H2,2-4H3/t26-,28-,30?/m1/s1 |
| InChIKey | SSBHLJLCTMHWLD-HAHKYSPUSA-N |
| XLogP | 7.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|