C29H33Cl2NO4 — CID 138641652
(5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-methylpiperidin-2-one (PubChem CID 138641652) has the molecular formula C29H33Cl2NO4 and a molecular weight of 530.49 g/mol. Its IUPAC name is (5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-methylpiperidin-2-one.
| Compound Name | (5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-methylpiperidin-2-one |
|---|---|
| PubChem CID | 138641652 |
| Molecular Formula | C29H33Cl2NO4 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | (5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-methylpiperidin-2-one |
| SMILES | C=C(/C=C\C(Cl)=C/C)[C@@H]1[C@@H](c2cccc(Cl)c2)CC(C)(CO)C(=O)N1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C29H33Cl2NO4/c1-6-22(30)12-10-19(2)27-25(20-8-7-9-23(31)14-20)16-29(3,18-33)28(34)32(27)17-21-11-13-24(35-4)15-26(21)36-5/h6-15,25,27,33H,2,16-18H2,1,3-5H3/b12-10-,22-6+/t25-,27-,29?/m1/s1 |
| InChIKey | VKXCVQUMBWKPCD-CCKGLYMISA-N |
| XLogP | 6.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|