C24H28ClNO3 — CID 138642353
(3R)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one (PubChem CID 138642353) has the molecular formula C24H28ClNO3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (3R)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 138642353 |
| Molecular Formula | C24H28ClNO3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (3R)-6-(4-chlorophenyl)-1-[(2,4-dimethoxyphenyl)methyl]-3-methyl-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)CCC(c2ccc(Cl)cc2)N(Cc2ccc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C24H28ClNO3/c1-5-13-24(2)14-12-21(17-6-9-19(25)10-7-17)26(23(24)27)16-18-8-11-20(28-3)15-22(18)29-4/h5-11,15,21H,1,12-14,16H2,2-4H3/t21?,24-/m0/s1 |
| InChIKey | NBSMZDCPWQEQQV-FHZUCYEKSA-N |
| XLogP | 5.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|