C17H22ClNO5 — CID 56624269
(3S,4R)-3-chloro-1-[(2,4-dimethoxyphenyl)methyl]-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one (PubChem CID 56624269) has the molecular formula C17H22ClNO5 and a molecular weight of 355.82 g/mol. Its IUPAC name is (3S,4R)-3-chloro-1-[(2,4-dimethoxyphenyl)methyl]-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one.
| Compound Name | (3S,4R)-3-chloro-1-[(2,4-dimethoxyphenyl)methyl]-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one |
|---|---|
| PubChem CID | 56624269 |
| Molecular Formula | C17H22ClNO5 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (3S,4R)-3-chloro-1-[(2,4-dimethoxyphenyl)methyl]-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]azetidin-2-one |
| SMILES | COc1ccc(CN2C(=O)[C@@H](Cl)[C@H]2[C@@H]2COC(C)(C)O2)c(OC)c1 |
| InChI | InChI=1S/C17H22ClNO5/c1-17(2)23-9-13(24-17)15-14(18)16(20)19(15)8-10-5-6-11(21-3)7-12(10)22-4/h5-7,13-15H,8-9H2,1-4H3/t13-,14-,15+/m0/s1 |
| InChIKey | QFRXZGZTIDNRND-SOUVJXGZSA-N |
| XLogP | 2.17 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|