C15H17NO5 — CID 10402014
(4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)azetidine-2,3-dione (PubChem CID 10402014) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)azetidine-2,3-dione.
| Compound Name | (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)azetidine-2,3-dione |
|---|---|
| PubChem CID | 10402014 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)azetidine-2,3-dione |
| SMILES | COc1ccc(N2C(=O)C(=O)[C@@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H17NO5/c1-15(2)20-8-11(21-15)12-13(17)14(18)16(12)9-4-6-10(19-3)7-5-9/h4-7,11-12H,8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | DZKOYKGVNQBFFY-NEPJUHHUSA-N |
| XLogP | 1.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|