C24H23NO4 — CID 177464762
(3E,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(4-methoxyphenyl)-3-(1-phenylprop-2-ynylidene)azetidin-2-one (PubChem CID 177464762) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is (3E,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(4-methoxyphenyl)-3-(1-phenylprop-2-ynylidene)azetidin-2-one.
| Compound Name | (3E,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(4-methoxyphenyl)-3-(1-phenylprop-2-ynylidene)azetidin-2-one |
|---|---|
| PubChem CID | 177464762 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (3E,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1-(4-methoxyphenyl)-3-(1-phenylprop-2-ynylidene)azetidin-2-one |
| SMILES | C#C/C(=C1\C(=O)N(c2ccc(OC)cc2)[C@H]1C1COC(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4/c1-5-19(16-9-7-6-8-10-16)21-22(20-15-28-24(2,3)29-20)25(23(21)26)17-11-13-18(27-4)14-12-17/h1,6-14,20,22H,15H2,2-4H3/b21-19+/t20?,22-/m0/s1 |
| InChIKey | SCQQHEXUYFBYNZ-AJTFKJSPSA-N |
| XLogP | 3.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|