C18H23NO5 — CID 100929843
(3R,4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one (PubChem CID 100929843) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3R,4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one.
| Compound Name | (3R,4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 100929843 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3R,4S)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-hydroxy-1-(4-methoxyphenyl)-3-prop-2-enylazetidin-2-one |
| SMILES | C=CC[C@]1(O)C(=O)N(c2ccc(OC)cc2)[C@H]1C1COC(C)(C)O1 |
| InChI | InChI=1S/C18H23NO5/c1-5-10-18(21)15(14-11-23-17(2,3)24-14)19(16(18)20)12-6-8-13(22-4)9-7-12/h5-9,14-15,21H,1,10-11H2,2-4H3/t14?,15-,18+/m0/s1 |
| InChIKey | WKJHGHLZXNWWNF-JGNLYWJMSA-N |
| XLogP | 1.87 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|