C21H34N2O4Si2 — CID 15666421
(3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one (PubChem CID 15666421) has the molecular formula C21H34N2O4Si2 and a molecular weight of 434.69 g/mol. Its IUPAC name is (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one.
| Compound Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one |
|---|---|
| PubChem CID | 15666421 |
| Molecular Formula | C21H34N2O4Si2 |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3R,4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-3-(2,2,5,5-tetramethyl-1,2,5-azadisilolidin-1-yl)azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@H](N3[Si](C)(C)CC[Si]3(C)C)[C@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H34N2O4Si2/c1-21(2)26-14-17(27-21)18-19(23-28(4,5)12-13-29(23,6)7)20(24)22(18)15-8-10-16(25-3)11-9-15/h8-11,17-19H,12-14H2,1-7H3/t17-,18-,19-/m1/s1 |
| InChIKey | KFSARCTYAMCRCK-GUDVDZBRSA-N |
| XLogP | 3.66 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|