C25H31NO10 — CID 10368864
[(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 10368864) has the molecular formula C25H31NO10 and a molecular weight of 505.52 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10368864 |
| Molecular Formula | C25H31NO10 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-[(2S,3R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-(4-methoxyphenyl)-4-oxoazetidin-3-yl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | COc1ccc(N2C(=O)[C@H](O[C@@H]3C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O3)[C@@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C25H31NO10/c1-14(27)31-12-19-18(33-15(2)28)10-11-21(34-19)35-23-22(20-13-32-25(3,4)36-20)26(24(23)29)16-6-8-17(30-5)9-7-16/h6-11,18-23H,12-13H2,1-5H3/t18-,19+,20+,21+,22-,23+/m0/s1 |
| InChIKey | IFXYTTIPHZTZCX-HZMAHWLLSA-N |
| XLogP | 1.72 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|