C27H29NO3Si — CID 11812305
(3R,4S)-3-[dimethyl(phenyl)silyl]oxy-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylazetidin-2-one (PubChem CID 11812305) has the molecular formula C27H29NO3Si and a molecular weight of 443.62 g/mol. Its IUPAC name is (3R,4S)-3-[dimethyl(phenyl)silyl]oxy-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylazetidin-2-one.
| Compound Name | (3R,4S)-3-[dimethyl(phenyl)silyl]oxy-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 11812305 |
| Molecular Formula | C27H29NO3Si |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (3R,4S)-3-[dimethyl(phenyl)silyl]oxy-1-(4-methoxyphenyl)-4-phenyl-3-prop-2-enylazetidin-2-one |
| SMILES | C=CC[C@]1(O[Si](C)(C)c2ccccc2)C(=O)N(c2ccc(OC)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H29NO3Si/c1-5-20-27(31-32(3,4)24-14-10-7-11-15-24)25(21-12-8-6-9-13-21)28(26(27)29)22-16-18-23(30-2)19-17-22/h5-19,25H,1,20H2,2-4H3/t25-,27+/m0/s1 |
| InChIKey | LZSQBJLVXRQXPU-AHKZPQOWSA-N |
| XLogP | 5.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|