C24H23NO3S — CID 101404324
(3S,4R)-3-benzylsulfanyl-3-methoxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one (PubChem CID 101404324) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is (3S,4R)-3-benzylsulfanyl-3-methoxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one.
| Compound Name | (3S,4R)-3-benzylsulfanyl-3-methoxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 101404324 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (3S,4R)-3-benzylsulfanyl-3-methoxy-1-(4-methoxyphenyl)-4-phenylazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@](OC)(SCc3ccccc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO3S/c1-27-21-15-13-20(14-16-21)25-22(19-11-7-4-8-12-19)24(28-2,23(25)26)29-17-18-9-5-3-6-10-18/h3-16,22H,17H2,1-2H3/t22-,24+/m1/s1 |
| InChIKey | NRLQAJXIKHQGMZ-VWNXMTODSA-N |
| XLogP | 5.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|