C24H23NO3 — CID 54114179
(3R,4S)-3-benzyl-1,4-bis(4-methoxyphenyl)azetidin-2-one (PubChem CID 54114179) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is (3R,4S)-3-benzyl-1,4-bis(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-3-benzyl-1,4-bis(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 54114179 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (3R,4S)-3-benzyl-1,4-bis(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc([C@@H]2[C@@H](Cc3ccccc3)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-27-20-12-8-18(9-13-20)23-22(16-17-6-4-3-5-7-17)24(26)25(23)19-10-14-21(28-2)15-11-19/h3-15,22-23H,16H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | NJEOHMKVKONEEO-DHIUTWEWSA-N |
| XLogP | 4.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |