C32H30N2O3 — CID 166443703
(5R,6S)-1,3,5-tribenzyl-6-(4-methoxyphenyl)-1,3-diazinane-2,4-dione (PubChem CID 166443703) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is (5R,6S)-1,3,5-tribenzyl-6-(4-methoxyphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | (5R,6S)-1,3,5-tribenzyl-6-(4-methoxyphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 166443703 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (5R,6S)-1,3,5-tribenzyl-6-(4-methoxyphenyl)-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(C2[C@@H](Cc3ccccc3)C(=O)N(Cc3ccccc3)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N2O3/c1-37-28-19-17-27(18-20-28)30-29(21-24-11-5-2-6-12-24)31(35)34(23-26-15-9-4-10-16-26)32(36)33(30)22-25-13-7-3-8-14-25/h2-20,29-30H,21-23H2,1H3/t29-,30?/m1/s1 |
| InChIKey | GBRQFYZCPNBDML-IDCGIGBZSA-N |
| XLogP | 6.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |