C25H24N2O2 — CID 134944587
(4R)-1-benzyl-3-[(4-methoxyphenyl)methyl]-4-phenyl-4H-pyrimidin-2-one (PubChem CID 134944587) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (4R)-1-benzyl-3-[(4-methoxyphenyl)methyl]-4-phenyl-4H-pyrimidin-2-one.
| Compound Name | (4R)-1-benzyl-3-[(4-methoxyphenyl)methyl]-4-phenyl-4H-pyrimidin-2-one |
|---|---|
| PubChem CID | 134944587 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (4R)-1-benzyl-3-[(4-methoxyphenyl)methyl]-4-phenyl-4H-pyrimidin-2-one |
| SMILES | COc1ccc(CN2C(=O)N(Cc3ccccc3)C=C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O2/c1-29-23-14-12-21(13-15-23)19-27-24(22-10-6-3-7-11-22)16-17-26(25(27)28)18-20-8-4-2-5-9-20/h2-17,24H,18-19H2,1H3/t24-/m1/s1 |
| InChIKey | WTTDVSDZYDZCDL-XMMPIXPASA-N |
| XLogP | 5.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |