C27H27FN2O2 — CID 24868146
(6Z)-1-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-5,8-dihydro-2H-1,4-diazocin-3-one (PubChem CID 24868146) has the molecular formula C27H27FN2O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is (6Z)-1-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-5,8-dihydro-2H-1,4-diazocin-3-one.
| Compound Name | (6Z)-1-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-5,8-dihydro-2H-1,4-diazocin-3-one |
|---|---|
| PubChem CID | 24868146 |
| Molecular Formula | C27H27FN2O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (6Z)-1-benzyl-4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-5,8-dihydro-2H-1,4-diazocin-3-one |
| SMILES | COc1ccc(C2/C=C\CN(Cc3ccccc3)CC(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H27FN2O2/c1-32-25-15-11-23(12-16-25)26-8-5-17-29(18-21-6-3-2-4-7-21)20-27(31)30(26)19-22-9-13-24(28)14-10-22/h2-16,26H,17-20H2,1H3/b8-5- |
| InChIKey | XNPGXORRLFJLCC-YVMONPNESA-N |
| XLogP | 4.98 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|