C23H25FN2O2 — CID 53356608
(4Z,10aS)-2-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,6,8,9,10,10a-hexahydropyrrolo[1,2-a][1,4]diazocin-1-one (PubChem CID 53356608) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is (4Z,10aS)-2-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,6,8,9,10,10a-hexahydropyrrolo[1,2-a][1,4]diazocin-1-one.
| Compound Name | (4Z,10aS)-2-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,6,8,9,10,10a-hexahydropyrrolo[1,2-a][1,4]diazocin-1-one |
|---|---|
| PubChem CID | 53356608 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (4Z,10aS)-2-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-3,6,8,9,10,10a-hexahydropyrrolo[1,2-a][1,4]diazocin-1-one |
| SMILES | COc1ccc(C2/C=C\CN3CCC[C@H]3C(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H25FN2O2/c1-28-20-12-8-18(9-13-20)21-4-2-14-25-15-3-5-22(25)23(27)26(21)16-17-6-10-19(24)11-7-17/h2,4,6-13,21-22H,3,5,14-16H2,1H3/b4-2-/t21?,22-/m0/s1 |
| InChIKey | XLLUCHJCSZUKEM-DSHAHXPZSA-N |
| XLogP | 3.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|