C30H27FN2O4S — CID 73229281
4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-naphthalen-2-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one (PubChem CID 73229281) has the molecular formula C30H27FN2O4S and a molecular weight of 530.62 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-naphthalen-2-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one.
| Compound Name | 4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-naphthalen-2-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one |
|---|---|
| PubChem CID | 73229281 |
| Molecular Formula | C30H27FN2O4S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-5-(4-methoxyphenyl)-1-naphthalen-2-ylsulfonyl-5,8-dihydro-2H-1,4-diazocin-3-one |
| SMILES | COc1ccc(C2C=CCN(S(=O)(=O)c3ccc4ccccc4c3)CC(=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H27FN2O4S/c1-37-27-15-10-24(11-16-27)29-7-4-18-32(21-30(34)33(29)20-22-8-13-26(31)14-9-22)38(35,36)28-17-12-23-5-2-3-6-25(23)19-28/h2-17,19,29H,18,20-21H2,1H3 |
| InChIKey | CNDHDPJWLGXBIS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|