C23H21NO — CID 58632784
(4S)-1,3-dibenzyl-4-phenylazetidin-2-one (PubChem CID 58632784) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is (4S)-1,3-dibenzyl-4-phenylazetidin-2-one.
| Compound Name | (4S)-1,3-dibenzyl-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 58632784 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (4S)-1,3-dibenzyl-4-phenylazetidin-2-one |
| SMILES | O=C1C(Cc2ccccc2)[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H21NO/c25-23-21(16-18-10-4-1-5-11-18)22(20-14-8-3-9-15-20)24(23)17-19-12-6-2-7-13-19/h1-15,21-22H,16-17H2/t21?,22-/m1/s1 |
| InChIKey | AZWLGDRXDMEASF-FOIFJWKZSA-N |
| XLogP | 4.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |