C16H16N2O — CID 40999549
(3S,4S)-3-amino-1-benzyl-4-phenylazetidin-2-one (PubChem CID 40999549) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (3S,4S)-3-amino-1-benzyl-4-phenylazetidin-2-one.
| Compound Name | (3S,4S)-3-amino-1-benzyl-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 40999549 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (3S,4S)-3-amino-1-benzyl-4-phenylazetidin-2-one |
| SMILES | N[C@@H]1C(=O)N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c17-14-15(13-9-5-2-6-10-13)18(16(14)19)11-12-7-3-1-4-8-12/h1-10,14-15H,11,17H2/t14-,15-/m0/s1 |
| InChIKey | JAUNCKDTAJDBHE-GJZGRUSLSA-N |
| XLogP | 2.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |