C22H19NO — CID 1236505
(3S,4S)-3-benzyl-1,4-diphenylazetidin-2-one (PubChem CID 1236505) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is (3S,4S)-3-benzyl-1,4-diphenylazetidin-2-one.
| Compound Name | (3S,4S)-3-benzyl-1,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 1236505 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (3S,4S)-3-benzyl-1,4-diphenylazetidin-2-one |
| SMILES | O=C1[C@@H](Cc2ccccc2)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C22H19NO/c24-22-20(16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)23(22)19-14-8-3-9-15-19/h1-15,20-21H,16H2/t20-,21+/m0/s1 |
| InChIKey | OAJDVBJWASMZHT-LEWJYISDSA-N |
| XLogP | 4.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |