C20H24NO4P — CID 101371767
(3R)-1-benzyl-3-diethoxyphosphoryl-4-phenylazetidin-2-one (PubChem CID 101371767) has the molecular formula C20H24NO4P and a molecular weight of 373.39 g/mol. Its IUPAC name is (3R)-1-benzyl-3-diethoxyphosphoryl-4-phenylazetidin-2-one.
| Compound Name | (3R)-1-benzyl-3-diethoxyphosphoryl-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 101371767 |
| Molecular Formula | C20H24NO4P |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3R)-1-benzyl-3-diethoxyphosphoryl-4-phenylazetidin-2-one |
| SMILES | CCOP(=O)(OCC)[C@H]1C(=O)N(Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C20H24NO4P/c1-3-24-26(23,25-4-2)19-18(17-13-9-6-10-14-17)21(20(19)22)15-16-11-7-5-8-12-16/h5-14,18-19H,3-4,15H2,1-2H3/t18?,19-/m1/s1 |
| InChIKey | KLHQLUPRKLHJEP-MUMRKEEXSA-N |
| XLogP | 4.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|