C20H26NO4P — CID 15180764
2-benzyl-5-diethoxyphosphoryl-3-phenyl-1,2-oxazolidine (PubChem CID 15180764) has the molecular formula C20H26NO4P and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-benzyl-5-diethoxyphosphoryl-3-phenyl-1,2-oxazolidine.
| Compound Name | 2-benzyl-5-diethoxyphosphoryl-3-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 15180764 |
| Molecular Formula | C20H26NO4P |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-benzyl-5-diethoxyphosphoryl-3-phenyl-1,2-oxazolidine |
| SMILES | CCOP(=O)(OCC)C1CC(c2ccccc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C20H26NO4P/c1-3-23-26(22,24-4-2)20-15-19(18-13-9-6-10-14-18)21(25-20)16-17-11-7-5-8-12-17/h5-14,19-20H,3-4,15-16H2,1-2H3 |
| InChIKey | NEENDKBLXQMKGI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|