C22H29NO — CID 11034663
(3R,5R)-2-benzyl-5-hexyl-3-phenyl-1,2-oxazolidine (PubChem CID 11034663) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is (3R,5R)-2-benzyl-5-hexyl-3-phenyl-1,2-oxazolidine.
| Compound Name | (3R,5R)-2-benzyl-5-hexyl-3-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 11034663 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (3R,5R)-2-benzyl-5-hexyl-3-phenyl-1,2-oxazolidine |
| SMILES | CCCCCC[C@@H]1C[C@H](c2ccccc2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C22H29NO/c1-2-3-4-11-16-21-17-22(20-14-9-6-10-15-20)23(24-21)18-19-12-7-5-8-13-19/h5-10,12-15,21-22H,2-4,11,16-18H2,1H3/t21-,22-/m1/s1 |
| InChIKey | BDHTXSCWIFKICF-FGZHOGPDSA-N |
| XLogP | 5.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|