C19H23NO — CID 125473975
(3R,5S)-5-butyl-2,3-diphenyl-1,2-oxazolidine (PubChem CID 125473975) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (3R,5S)-5-butyl-2,3-diphenyl-1,2-oxazolidine.
| Compound Name | (3R,5S)-5-butyl-2,3-diphenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 125473975 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (3R,5S)-5-butyl-2,3-diphenyl-1,2-oxazolidine |
| SMILES | CCCC[C@H]1C[C@H](c2ccccc2)N(c2ccccc2)O1 |
| InChI | InChI=1S/C19H23NO/c1-2-3-14-18-15-19(16-10-6-4-7-11-16)20(21-18)17-12-8-5-9-13-17/h4-13,18-19H,2-3,14-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | TWLPZOZOGASMPP-RBUKOAKNSA-N |
| XLogP | 5.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |