C18H27NO2 — CID 10989878
(2R,3aR,5S)-2-butyl-7,7-dimethyl-5-phenyl-3,3a,5,6-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine (PubChem CID 10989878) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2R,3aR,5S)-2-butyl-7,7-dimethyl-5-phenyl-3,3a,5,6-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine.
| Compound Name | (2R,3aR,5S)-2-butyl-7,7-dimethyl-5-phenyl-3,3a,5,6-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine |
|---|---|
| PubChem CID | 10989878 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2R,3aR,5S)-2-butyl-7,7-dimethyl-5-phenyl-3,3a,5,6-tetrahydro-2H-[1,2]oxazolo[3,2-b][1,3]oxazine |
| SMILES | CCCC[C@@H]1C[C@H]2O[C@H](c3ccccc3)CC(C)(C)N2O1 |
| InChI | InChI=1S/C18H27NO2/c1-4-5-11-15-12-17-19(21-15)18(2,3)13-16(20-17)14-9-7-6-8-10-14/h6-10,15-17H,4-5,11-13H2,1-3H3/t15-,16+,17-/m1/s1 |
| InChIKey | DRNBCGPGDVMRMV-IXDOHACOSA-N |
| XLogP | 4.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |