C15H22O — CID 131845672
(2R,6S)-2-butyl-6-phenyloxane (PubChem CID 131845672) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2R,6S)-2-butyl-6-phenyloxane.
| Compound Name | (2R,6S)-2-butyl-6-phenyloxane |
|---|---|
| PubChem CID | 131845672 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2R,6S)-2-butyl-6-phenyloxane |
| SMILES | CCCC[C@@H]1CCC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H22O/c1-2-3-10-14-11-7-12-15(16-14)13-8-5-4-6-9-13/h4-6,8-9,14-15H,2-3,7,10-12H2,1H3/t14-,15+/m1/s1 |
| InChIKey | USJZFWOZCWCULM-CABCVRRESA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |