C17H25NO — CID 164609782
1-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]pyrrolidine (PubChem CID 164609782) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]pyrrolidine.
| Compound Name | 1-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 164609782 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-[2-[(2R,6S)-6-phenyloxan-2-yl]ethyl]pyrrolidine |
| SMILES | c1ccc([C@@H]2CCC[C@H](CCN3CCCC3)O2)cc1 |
| InChI | InChI=1S/C17H25NO/c1-2-7-15(8-3-1)17-10-6-9-16(19-17)11-14-18-12-4-5-13-18/h1-3,7-8,16-17H,4-6,9-14H2/t16-,17+/m1/s1 |
| InChIKey | HRRSTZUNRHHAEU-SJORKVTESA-N |
| XLogP | 3.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |