C12H13NO — CID 58035350
(2R,6S)-6-phenyloxane-2-carbonitrile (PubChem CID 58035350) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is (2R,6S)-6-phenyloxane-2-carbonitrile.
| Compound Name | (2R,6S)-6-phenyloxane-2-carbonitrile |
|---|---|
| PubChem CID | 58035350 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (2R,6S)-6-phenyloxane-2-carbonitrile |
| SMILES | N#C[C@H]1CCC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C12H13NO/c13-9-11-7-4-8-12(14-11)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-8H2/t11-,12+/m1/s1 |
| InChIKey | GYHDGCJYZWKSKJ-NEPJUHHUSA-N |
| XLogP | 2.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |