C15H20O — CID 134961607
(2R,4aS,8aR)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene (PubChem CID 134961607) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (2R,4aS,8aR)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene.
| Compound Name | (2R,4aS,8aR)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
|---|---|
| PubChem CID | 134961607 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2R,4aS,8aR)-2-phenyl-3,4,4a,5,6,7,8,8a-octahydro-2H-chromene |
| SMILES | c1ccc([C@H]2CC[C@@H]3CCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C15H20O/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-3,6-7,13-15H,4-5,8-11H2/t13-,14+,15+/m0/s1 |
| InChIKey | FVCACEIFXBOOGH-RRFJBIMHSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |