C11H13IO — CID 101241677
(2S,5S)-2-(iodomethyl)-5-phenyloxolane (PubChem CID 101241677) has the molecular formula C11H13IO and a molecular weight of 288.13 g/mol. Its IUPAC name is (2S,5S)-2-(iodomethyl)-5-phenyloxolane.
| Compound Name | (2S,5S)-2-(iodomethyl)-5-phenyloxolane |
|---|---|
| PubChem CID | 101241677 |
| Molecular Formula | C11H13IO |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (2S,5S)-2-(iodomethyl)-5-phenyloxolane |
| SMILES | IC[C@@H]1CC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C11H13IO/c12-8-10-6-7-11(13-10)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | LXZBQHGUWKJHPZ-QWRGUYRKSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|