C18H19IO2 — CID 46223813
(2R,4S,6R)-2-(iodomethyl)-4,6-diphenyloxan-4-ol (PubChem CID 46223813) has the molecular formula C18H19IO2 and a molecular weight of 394.25 g/mol. Its IUPAC name is (2R,4S,6R)-2-(iodomethyl)-4,6-diphenyloxan-4-ol.
| Compound Name | (2R,4S,6R)-2-(iodomethyl)-4,6-diphenyloxan-4-ol |
|---|---|
| PubChem CID | 46223813 |
| Molecular Formula | C18H19IO2 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2R,4S,6R)-2-(iodomethyl)-4,6-diphenyloxan-4-ol |
| SMILES | O[C@]1(c2ccccc2)C[C@H](CI)O[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H19IO2/c19-13-16-11-18(20,15-9-5-2-6-10-15)12-17(21-16)14-7-3-1-4-8-14/h1-10,16-17,20H,11-13H2/t16-,17-,18-/m1/s1 |
| InChIKey | FEBJXRPOMPVXKN-KZNAEPCWSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|