C14H18O2S — CID 171951990
9-oxo-3-phenyl-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171951990) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 9-oxo-3-phenyl-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-oxo-3-phenyl-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171951990 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 9-oxo-3-phenyl-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1C2CCCC1CC(O)(c1ccccc1)C2 |
| InChI | InChI=1S/C14H18O2S/c15-14(11-5-2-1-3-6-11)9-12-7-4-8-13(10-14)17(12)16/h1-3,5-6,12-13,15H,4,7-10H2 |
| InChIKey | RTVHCENKOZMYMN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |