C17H22O2S — CID 171962087
9-oxo-3-(4-prop-1-en-2-ylphenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171962087) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 9-oxo-3-(4-prop-1-en-2-ylphenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-oxo-3-(4-prop-1-en-2-ylphenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171962087 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 9-oxo-3-(4-prop-1-en-2-ylphenyl)-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | C=C(C)c1ccc(C2(O)CC3CCCC(C2)S3=O)cc1 |
| InChI | InChI=1S/C17H22O2S/c1-12(2)13-6-8-14(9-7-13)17(18)10-15-4-3-5-16(11-17)20(15)19/h6-9,15-16,18H,1,3-5,10-11H2,2H3 |
| InChIKey | WZHNKNCBWCHUNT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |