C17H22OS — CID 171962086
3-(4-prop-1-en-2-ylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171962086) has the molecular formula C17H22OS and a molecular weight of 274.43 g/mol. Its IUPAC name is 3-(4-prop-1-en-2-ylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(4-prop-1-en-2-ylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171962086 |
| Molecular Formula | C17H22OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-(4-prop-1-en-2-ylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | C=C(C)c1ccc(C2(O)CC3CCCC(C2)S3)cc1 |
| InChI | InChI=1S/C17H22OS/c1-12(2)13-6-8-14(9-7-13)17(18)10-15-4-3-5-16(11-17)19-15/h6-9,15-16,18H,1,3-5,10-11H2,2H3 |
| InChIKey | VYARLSHWFUWTAB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |