C16H22OS — CID 171958953
3-(3,5-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171958953) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(3,5-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171958953 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1cc(C)cc(C2(O)CC3CCCC(C2)S3)c1 |
| InChI | InChI=1S/C16H22OS/c1-11-6-12(2)8-13(7-11)16(17)9-14-4-3-5-15(10-16)18-14/h6-8,14-15,17H,3-5,9-10H2,1-2H3 |
| InChIKey | AUBOXNSKBMIPQH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |