C17H24O2S — CID 171954874
3-(4-methoxy-2,6-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171954874) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is 3-(4-methoxy-2,6-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(4-methoxy-2,6-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171954874 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-(4-methoxy-2,6-dimethylphenyl)-9-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | COc1cc(C)c(C2(O)CC3CCCC(C2)S3)c(C)c1 |
| InChI | InChI=1S/C17H24O2S/c1-11-7-13(19-3)8-12(2)16(11)17(18)9-14-5-4-6-15(10-17)20-14/h7-8,14-15,18H,4-6,9-10H2,1-3H3 |
| InChIKey | PBAOMKXAMJDKFN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |