C16H16F3NO2S — CID 171956743
4-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 171956743) has the molecular formula C16H16F3NO2S and a molecular weight of 343.37 g/mol. Its IUPAC name is 4-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 171956743 |
| Molecular Formula | C16H16F3NO2S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(C2(O)CC3CCCC(C2)S3=O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO2S/c17-16(18,19)14-6-11(5-4-10(14)9-20)15(21)7-12-2-1-3-13(8-15)23(12)22/h4-6,12-13,21H,1-3,7-8H2 |
| InChIKey | KWJQRKWLLZWTLQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |