C15H19FO3S — CID 171961576
3-(3-fluoro-5-methoxyphenyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171961576) has the molecular formula C15H19FO3S and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-(3-fluoro-5-methoxyphenyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(3-fluoro-5-methoxyphenyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171961576 |
| Molecular Formula | C15H19FO3S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-(3-fluoro-5-methoxyphenyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | COc1cc(F)cc(C2(O)CC3CCCC(C2)S3=O)c1 |
| InChI | InChI=1S/C15H19FO3S/c1-19-12-6-10(5-11(16)7-12)15(17)8-13-3-2-4-14(9-15)20(13)18/h5-7,13-14,17H,2-4,8-9H2,1H3 |
| InChIKey | DIDNIEYOBUQGLL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |