C14H18FNO3S — CID 171960383
3-(5-fluoro-2-methoxy-3-pyridinyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171960383) has the molecular formula C14H18FNO3S and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxy-3-pyridinyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(5-fluoro-2-methoxy-3-pyridinyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171960383 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-(5-fluoro-2-methoxy-3-pyridinyl)-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | COc1ncc(F)cc1C1(O)CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C14H18FNO3S/c1-19-13-12(5-9(15)8-16-13)14(17)6-10-3-2-4-11(7-14)20(10)18/h5,8,10-11,17H,2-4,6-7H2,1H3 |
| InChIKey | UWHHROWXPKBKNZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |