C12H14FNO2S — CID 171964652
3-(5-fluoro-2-pyridinyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171964652) has the molecular formula C12H14FNO2S and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-(5-fluoro-2-pyridinyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(5-fluoro-2-pyridinyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171964652 |
| Molecular Formula | C12H14FNO2S |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(5-fluoro-2-pyridinyl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1C2CCC1CC(O)(c1ccc(F)cn1)C2 |
| InChI | InChI=1S/C12H14FNO2S/c13-8-1-4-11(14-7-8)12(15)5-9-2-3-10(6-12)17(9)16/h1,4,7,9-10,15H,2-3,5-6H2 |
| InChIKey | HZXBOICTLFAAIB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |