C13H13F3O2S — CID 171962547
8-oxo-3-(2,3,6-trifluorophenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171962547) has the molecular formula C13H13F3O2S and a molecular weight of 290.31 g/mol. Its IUPAC name is 8-oxo-3-(2,3,6-trifluorophenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-oxo-3-(2,3,6-trifluorophenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171962547 |
| Molecular Formula | C13H13F3O2S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 8-oxo-3-(2,3,6-trifluorophenyl)-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1C2CCC1CC(O)(c1c(F)ccc(F)c1F)C2 |
| InChI | InChI=1S/C13H13F3O2S/c14-9-3-4-10(15)12(16)11(9)13(17)5-7-1-2-8(6-13)19(7)18/h3-4,7-8,17H,1-2,5-6H2 |
| InChIKey | LEJIWYDUNQBUJG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|