C15H17F3O3S — CID 171956959
3-[3-methoxy-4-(trifluoromethyl)phenyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171956959) has the molecular formula C15H17F3O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-[3-methoxy-4-(trifluoromethyl)phenyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[3-methoxy-4-(trifluoromethyl)phenyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171956959 |
| Molecular Formula | C15H17F3O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-[3-methoxy-4-(trifluoromethyl)phenyl]-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1cc(C2(O)CC3CCC(C2)S3=O)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3O3S/c1-21-13-6-9(2-5-12(13)15(16,17)18)14(19)7-10-3-4-11(8-14)22(10)20/h2,5-6,10-11,19H,3-4,7-8H2,1H3 |
| InChIKey | YXIRPDGHLMDWNV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |