C18H20O3S — CID 171957356
3-(6-methoxynaphthalen-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171957356) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-(6-methoxynaphthalen-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(6-methoxynaphthalen-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171957356 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-(6-methoxynaphthalen-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1ccc2cc(C3(O)CC4CCC(C3)S4=O)ccc2c1 |
| InChI | InChI=1S/C18H20O3S/c1-21-15-5-3-12-8-14(4-2-13(12)9-15)18(19)10-16-6-7-17(11-18)22(16)20/h2-5,8-9,16-17,19H,6-7,10-11H2,1H3 |
| InChIKey | HRKKEMNOCLQENR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |