C22H24O2S — CID 171953749
3-(9,9-dimethylfluoren-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171953749) has the molecular formula C22H24O2S and a molecular weight of 352.50 g/mol. Its IUPAC name is 3-(9,9-dimethylfluoren-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(9,9-dimethylfluoren-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171953749 |
| Molecular Formula | C22H24O2S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-(9,9-dimethylfluoren-2-yl)-8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | CC1(C)c2ccccc2-c2ccc(C3(O)CC4CCC(C3)S4=O)cc21 |
| InChI | InChI=1S/C22H24O2S/c1-21(2)19-6-4-3-5-17(19)18-10-7-14(11-20(18)21)22(23)12-15-8-9-16(13-22)25(15)24/h3-7,10-11,15-16,23H,8-9,12-13H2,1-2H3 |
| InChIKey | OAQZLLGUKVJSIT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |