C53H43BrO2 — CID 58175542
7-bromo-14,21-bis(9,9-dimethylfluoren-2-yl)-10,10-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol (PubChem CID 58175542) has the molecular formula C53H43BrO2 and a molecular weight of 791.83 g/mol. Its IUPAC name is 7-bromo-14,21-bis(9,9-dimethylfluoren-2-yl)-10,10-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol.
| Compound Name | 7-bromo-14,21-bis(9,9-dimethylfluoren-2-yl)-10,10-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol |
|---|---|
| PubChem CID | 58175542 |
| Molecular Formula | C53H43BrO2 |
| Molecular Weight | 791.83 g/mol |
| Exact Mass | 790.24 |
| IUPAC Name | 7-bromo-14,21-bis(9,9-dimethylfluoren-2-yl)-10,10-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol |
| SMILES | CC1(C)c2ccccc2-c2ccc(C3(O)c4ccccc4C(O)(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4cc5c(cc43)-c3ccc(Br)cc3C5(C)C)cc21 |
| InChI | InChI=1S/C53H43BrO2/c1-49(2)39-15-9-7-13-33(39)35-22-19-30(25-43(35)49)52(55)41-17-11-12-18-42(41)53(56,31-20-23-36-34-14-8-10-16-40(34)50(3,4)44(36)26-31)48-29-46-38(28-47(48)52)37-24-21-32(54)27-45(37)51(46,5)6/h7-29,55-56H,1-6H3 |
| InChIKey | SXSKNVHYVGCWHZ-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.83 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |