C28H23BrO2 — CID 122205730
2-bromo-9,10-bis(4-methylphenyl)anthracene-9,10-diol (PubChem CID 122205730) has the molecular formula C28H23BrO2 and a molecular weight of 471.39 g/mol. Its IUPAC name is 2-bromo-9,10-bis(4-methylphenyl)anthracene-9,10-diol.
| Compound Name | 2-bromo-9,10-bis(4-methylphenyl)anthracene-9,10-diol |
|---|---|
| PubChem CID | 122205730 |
| Molecular Formula | C28H23BrO2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-bromo-9,10-bis(4-methylphenyl)anthracene-9,10-diol |
| SMILES | Cc1ccc(C2(O)c3ccccc3C(O)(c3ccc(C)cc3)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C28H23BrO2/c1-18-7-11-20(12-8-18)27(30)23-5-3-4-6-24(23)28(31,21-13-9-19(2)10-14-21)26-17-22(29)15-16-25(26)27/h3-17,30-31H,1-2H3 |
| InChIKey | UKJSNYXLIIHYHG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |