C22H22O — CID 91233628
ethane;9-(4-methylphenyl)fluoren-9-ol (PubChem CID 91233628) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is ethane;9-(4-methylphenyl)fluoren-9-ol.
| Compound Name | ethane;9-(4-methylphenyl)fluoren-9-ol |
|---|---|
| PubChem CID | 91233628 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | ethane;9-(4-methylphenyl)fluoren-9-ol |
| SMILES | CC.Cc1ccc(C2(O)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C20H16O.C2H6/c1-14-10-12-15(13-11-14)20(21)18-8-4-2-6-16(18)17-7-3-5-9-19(17)20;1-2/h2-13,21H,1H3;1-2H3 |
| InChIKey | BPXKFJKEKHIRDD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |