C42H32Br2Cl2O2 — CID 158367808
acetyl bromide;9-bromo-9-(4-chlorophenyl)-2-methylfluorene;9-(4-chlorophenyl)-2-methylfluoren-9-ol (PubChem CID 158367808) has the molecular formula C42H32Br2Cl2O2 and a molecular weight of 799.43 g/mol. Its IUPAC name is acetyl bromide;9-bromo-9-(4-chlorophenyl)-2-methylfluorene;9-(4-chlorophenyl)-2-methylfluoren-9-ol.
| Compound Name | acetyl bromide;9-bromo-9-(4-chlorophenyl)-2-methylfluorene;9-(4-chlorophenyl)-2-methylfluoren-9-ol |
|---|---|
| PubChem CID | 158367808 |
| Molecular Formula | C42H32Br2Cl2O2 |
| Molecular Weight | 799.43 g/mol |
| Exact Mass | 796.01 |
| IUPAC Name | acetyl bromide;9-bromo-9-(4-chlorophenyl)-2-methylfluorene;9-(4-chlorophenyl)-2-methylfluoren-9-ol |
| SMILES | CC(=O)Br.Cc1ccc2c(c1)C(Br)(c1ccc(Cl)cc1)c1ccccc1-2.Cc1ccc2c(c1)C(O)(c1ccc(Cl)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C20H14BrCl.C20H15ClO.C2H3BrO/c1-13-6-11-17-16-4-2-3-5-18(16)20(21,19(17)12-13)14-7-9-15(22)10-8-14;1-13-6-11-17-16-4-2-3-5-18(16)20(22,19(17)12-13)14-7-9-15(21)10-8-14;1-2(3)4/h2-12H,1H3;2-12,22H,1H3;1H3 |
| InChIKey | GUFZSSFHQLTNRM-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.43 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|