C32H24O4 — CID 102399421
(2E)-3-hydroxy-2-[1-hydroxy-1-(4-methylphenyl)-3-oxoinden-2-ylidene]-3-(4-methylphenyl)inden-1-one (PubChem CID 102399421) has the molecular formula C32H24O4 and a molecular weight of 472.54 g/mol. Its IUPAC name is (2E)-3-hydroxy-2-[1-hydroxy-1-(4-methylphenyl)-3-oxoinden-2-ylidene]-3-(4-methylphenyl)inden-1-one.
| Compound Name | (2E)-3-hydroxy-2-[1-hydroxy-1-(4-methylphenyl)-3-oxoinden-2-ylidene]-3-(4-methylphenyl)inden-1-one |
|---|---|
| PubChem CID | 102399421 |
| Molecular Formula | C32H24O4 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (2E)-3-hydroxy-2-[1-hydroxy-1-(4-methylphenyl)-3-oxoinden-2-ylidene]-3-(4-methylphenyl)inden-1-one |
| SMILES | Cc1ccc(C2(O)/C(=C3\C(=O)c4ccccc4C3(O)c3ccc(C)cc3)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H24O4/c1-19-11-15-21(16-12-19)31(35)25-9-5-3-7-23(25)29(33)27(31)28-30(34)24-8-4-6-10-26(24)32(28,36)22-17-13-20(2)14-18-22/h3-18,35-36H,1-2H3/b28-27+ |
| InChIKey | AYZGMJBCBAWXCD-BYYHNAKLSA-N |
| XLogP | 5.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|